C12H13Cl2NO4S2 — CID 80583828
2,4-dichloro-5-(thiolan-2-ylmethylsulfamoyl)benzoic acid (PubChem CID 80583828) has the molecular formula C12H13Cl2NO4S2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 2,4-dichloro-5-(thiolan-2-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(thiolan-2-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 80583828 |
| Molecular Formula | C12H13Cl2NO4S2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 2,4-dichloro-5-(thiolan-2-ylmethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC2CCCS2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO4S2/c13-9-5-10(14)11(4-8(9)12(16)17)21(18,19)15-6-7-2-1-3-20-7/h4-5,7,15H,1-3,6H2,(H,16,17) |
| InChIKey | QUPDQHUSUGAJLJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |