C10H11Cl2NO6S — CID 66170591
2,4-dichloro-5-(2,3-dihydroxypropylsulfamoyl)benzoic acid (PubChem CID 66170591) has the molecular formula C10H11Cl2NO6S and a molecular weight of 344.17 g/mol. Its IUPAC name is 2,4-dichloro-5-(2,3-dihydroxypropylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(2,3-dihydroxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 66170591 |
| Molecular Formula | C10H11Cl2NO6S |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 2,4-dichloro-5-(2,3-dihydroxypropylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC(O)CO)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2NO6S/c11-7-2-8(12)9(1-6(7)10(16)17)20(18,19)13-3-5(15)4-14/h1-2,5,13-15H,3-4H2,(H,16,17) |
| InChIKey | VTAKHHQRCROCAW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |