C9H10Cl3NO3S — CID 25252490
2,4,5-trichloro-N-(2-hydroxypropyl)benzenesulfonamide (PubChem CID 25252490) has the molecular formula C9H10Cl3NO3S and a molecular weight of 318.61 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(2-hydroxypropyl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(2-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 25252490 |
| Molecular Formula | C9H10Cl3NO3S |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2,4,5-trichloro-N-(2-hydroxypropyl)benzenesulfonamide |
| SMILES | CC(O)CNS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3NO3S/c1-5(14)4-13-17(15,16)9-3-7(11)6(10)2-8(9)12/h2-3,5,13-14H,4H2,1H3 |
| InChIKey | FANUFVJFADXNSO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|