C11H13ClN2O4S — CID 43502382
6-chloro-N-(2-hydroxypropyl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 43502382) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is 6-chloro-N-(2-hydroxypropyl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 6-chloro-N-(2-hydroxypropyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 43502382 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 6-chloro-N-(2-hydroxypropyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CC(O)CNS(=O)(=O)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C11H13ClN2O4S/c1-6(15)5-13-19(17,18)10-2-7-3-11(16)14-9(7)4-8(10)12/h2,4,6,13,15H,3,5H2,1H3,(H,14,16) |
| InChIKey | UNUXLMSYTBMLKJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |