C12H16ClN3O3S — CID 65194062
N-(1-aminobutan-2-yl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 65194062) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(1-aminobutan-2-yl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 65194062 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(1-aminobutan-2-yl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CCC(CN)NS(=O)(=O)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C12H16ClN3O3S/c1-2-8(6-14)16-20(18,19)11-3-7-4-12(17)15-10(7)5-9(11)13/h3,5,8,16H,2,4,6,14H2,1H3,(H,15,17) |
| InChIKey | MCZGIMXNHVXSRX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |