C11H10BrClN2O3S — CID 113465023
N-(2-bromoprop-2-enyl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 113465023) has the molecular formula C11H10BrClN2O3S and a molecular weight of 365.64 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(2-bromoprop-2-enyl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 113465023 |
| Molecular Formula | C11H10BrClN2O3S |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | C=C(Br)CNS(=O)(=O)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C11H10BrClN2O3S/c1-6(12)5-14-19(17,18)10-2-7-3-11(16)15-9(7)4-8(10)13/h2,4,14H,1,3,5H2,(H,15,16) |
| InChIKey | YHPUWWOCPIKWIE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |