C16H15ClN2O3S — CID 44634854
6-chloro-N-(3,4-dimethylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 44634854) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dimethylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 6-chloro-N-(3,4-dimethylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 44634854 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 6-chloro-N-(3,4-dimethylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc3c(cc2Cl)NC(=O)C3)cc1C |
| InChI | InChI=1S/C16H15ClN2O3S/c1-9-3-4-12(5-10(9)2)19-23(21,22)15-6-11-7-16(20)18-14(11)8-13(15)17/h3-6,8,19H,7H2,1-2H3,(H,18,20) |
| InChIKey | XRRWVAJHXHPVMF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |