C11H14ClNO — CID 144928829
6-chloro-5-methyl-1,3-dihydroindol-2-one;ethane (PubChem CID 144928829) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 6-chloro-5-methyl-1,3-dihydroindol-2-one;ethane.
| Compound Name | 6-chloro-5-methyl-1,3-dihydroindol-2-one;ethane |
|---|---|
| PubChem CID | 144928829 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-chloro-5-methyl-1,3-dihydroindol-2-one;ethane |
| SMILES | CC.Cc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C9H8ClNO.C2H6/c1-5-2-6-3-9(12)11-8(6)4-7(5)10;1-2/h2,4H,3H2,1H3,(H,11,12);1-2H3 |
| InChIKey | GGBPXTFIWRERQV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |