C13H21NO — CID 91234498
ethane;5-methyl-1,3-dihydroindol-2-one (PubChem CID 91234498) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;5-methyl-1,3-dihydroindol-2-one.
| Compound Name | ethane;5-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91234498 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethane;5-methyl-1,3-dihydroindol-2-one |
| SMILES | CC.CC.Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C9H9NO.2C2H6/c1-6-2-3-8-7(4-6)5-9(11)10-8;2*1-2/h2-4H,5H2,1H3,(H,10,11);2*1-2H3 |
| InChIKey | NTKRPIFMVFMKHQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |