C14H21NO2 — CID 143015596
ethane;7-methyl-4H-isoquinoline-1,3-dione (PubChem CID 143015596) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is ethane;7-methyl-4H-isoquinoline-1,3-dione.
| Compound Name | ethane;7-methyl-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 143015596 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethane;7-methyl-4H-isoquinoline-1,3-dione |
| SMILES | CC.CC.Cc1ccc2c(c1)C(=O)NC(=O)C2 |
| InChI | InChI=1S/C10H9NO2.2C2H6/c1-6-2-3-7-5-9(12)11-10(13)8(7)4-6;2*1-2/h2-4H,5H2,1H3,(H,11,12,13);2*1-2H3 |
| InChIKey | QKCOWUGXQWLYSA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|