About acetic acid;4H-isoquinoline-1,3-dione
acetic acid;4H-isoquinoline-1,3-dione (PubChem CID 67841209) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is acetic acid;4H-isoquinoline-1,3-dione.
Molecular Properties
| Compound Name | acetic acid;4H-isoquinoline-1,3-dione |
| PubChem CID | 67841209 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | acetic acid;4H-isoquinoline-1,3-dione |
| SMILES | CC(=O)O.O=C1Cc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C9H7NO2.C2H4O2/c11-8-5-6-3-1-2-4-7(6)9(12)10-8;1-2(3)4/h1-4H,5H2,(H,10,11,12);1H3,(H,3,4) |
| InChIKey | MHYCWVQXHOFOIZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;4H-isoquinoline-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4H-isoquinoline-1,3-dione?
The IUPAC name of acetic acid;4H-isoquinoline-1,3-dione (CID 67841209) is acetic acid;4H-isoquinoline-1,3-dione.
What is the SMILES notation for acetic acid;4H-isoquinoline-1,3-dione?
The canonical SMILES for acetic acid;4H-isoquinoline-1,3-dione is CC(=O)O.O=C1Cc2ccccc2C(=O)N1.
What is the InChIKey of acetic acid;4H-isoquinoline-1,3-dione?
The InChIKey is MHYCWVQXHOFOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C2H4O2/c11-8-5-6-3-1-2-4-7(6)9(12)10-8;1-2(3)4/h1-4H,5H2,(H,10,11,12);1H3,(H,3,4).
What are the key properties of acetic acid;4H-isoquinoline-1,3-dione?
acetic acid;4H-isoquinoline-1,3-dione has a molecular weight of 221.21 g/mol, XLogP of 0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4H-isoquinoline-1,3-dione is sourced from PubChem (CID 67841209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).