C11H11NO4 — CID 67841209
acetic acid;4H-isoquinoline-1,3-dione (PubChem CID 67841209) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is acetic acid;4H-isoquinoline-1,3-dione.
| Compound Name | acetic acid;4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 67841209 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | acetic acid;4H-isoquinoline-1,3-dione |
| SMILES | CC(=O)O.O=C1Cc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C9H7NO2.C2H4O2/c11-8-5-6-3-1-2-4-7(6)9(12)10-8;1-2(3)4/h1-4H,5H2,(H,10,11,12);1H3,(H,3,4) |
| InChIKey | MHYCWVQXHOFOIZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|