C9H5NO3 — CID 10640
isoquinoline-1,3,4-trione (PubChem CID 10640) has the molecular formula C9H5NO3 and a molecular weight of 175.14 g/mol. Its IUPAC name is isoquinoline-1,3,4-trione.
| Compound Name | isoquinoline-1,3,4-trione |
|---|---|
| PubChem CID | 10640 |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | isoquinoline-1,3,4-trione |
| SMILES | O=C1NC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C9H5NO3/c11-7-5-3-1-2-4-6(5)8(12)10-9(7)13/h1-4H,(H,10,12,13) |
| InChIKey | YIOFGHHAURBGSJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|