C16H11NO3 — CID 11357566
2-benzylisoquinoline-1,3,4-trione (PubChem CID 11357566) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-benzylisoquinoline-1,3,4-trione.
| Compound Name | 2-benzylisoquinoline-1,3,4-trione |
|---|---|
| PubChem CID | 11357566 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-benzylisoquinoline-1,3,4-trione |
| SMILES | O=C1C(=O)N(Cc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H11NO3/c18-14-12-8-4-5-9-13(12)15(19)17(16(14)20)10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | MCRWFXGWJMDFON-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|