C11H13NO2 — CID 91307302
ethane;4H-isoquinoline-1,3-dione (PubChem CID 91307302) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is ethane;4H-isoquinoline-1,3-dione.
| Compound Name | ethane;4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 91307302 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | ethane;4H-isoquinoline-1,3-dione |
| SMILES | CC.O=C1Cc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C9H7NO2.C2H6/c11-8-5-6-3-1-2-4-7(6)9(12)10-8;1-2/h1-4H,5H2,(H,10,11,12);1-2H3 |
| InChIKey | BWPXNHYXQJDVTG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|