About 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one
1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one (PubChem CID 67943327) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one |
| PubChem CID | 67943327 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one |
| SMILES | Nc1cccc2c1Cc1ccccc1C(=O)N2 |
| InChI | InChI=1S/C14H12N2O/c15-12-6-3-7-13-11(12)8-9-4-1-2-5-10(9)14(17)16-13/h1-7H,8,15H2,(H,16,17) |
| InChIKey | RTWXXAKEIMRRLC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one?
The IUPAC name of 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one (CID 67943327) is 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one.
What is the SMILES notation for 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one?
The canonical SMILES for 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one is Nc1cccc2c1Cc1ccccc1C(=O)N2.
What is the InChIKey of 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one?
The InChIKey is RTWXXAKEIMRRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c15-12-6-3-7-13-11(12)8-9-4-1-2-5-10(9)14(17)16-13/h1-7H,8,15H2,(H,16,17).
What are the key properties of 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one?
1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one has a molecular weight of 224.26 g/mol, XLogP of 2.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-5,11-dihydrobenzo[c][1]benzazepin-6-one is sourced from PubChem (CID 67943327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).