C9H10N2O — CID 124925857
8-amino-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 124925857) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 8-amino-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 8-amino-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 124925857 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 8-amino-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | Nc1cccc2c1CNC(=O)C2 |
| InChI | InChI=1S/C9H10N2O/c10-8-3-1-2-6-4-9(12)11-5-7(6)8/h1-3H,4-5,10H2,(H,11,12) |
| InChIKey | DNENDCDWAAGALP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|