About 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane
9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane (PubChem CID 145093037) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane.
Molecular Properties
| Compound Name | 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane |
| PubChem CID | 145093037 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane |
| SMILES | CC.Nc1cccc2c1OCC(=O)NC2 |
| InChI | InChI=1S/C9H10N2O2.C2H6/c10-7-3-1-2-6-4-11-8(12)5-13-9(6)7;1-2/h1-3H,4-5,10H2,(H,11,12);1-2H3 |
| InChIKey | PMKUICWAAMEAEH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane?
The IUPAC name of 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane (CID 145093037) is 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane.
What is the SMILES notation for 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane?
The canonical SMILES for 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane is CC.Nc1cccc2c1OCC(=O)NC2.
What is the InChIKey of 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane?
The InChIKey is PMKUICWAAMEAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2.C2H6/c10-7-3-1-2-6-4-11-8(12)5-13-9(6)7;1-2/h1-3H,4-5,10H2,(H,11,12);1-2H3.
What are the key properties of 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane?
9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane has a molecular weight of 208.26 g/mol, XLogP of 1.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane is sourced from PubChem (CID 145093037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).