C11H16N2O2 — CID 145093037
9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane (PubChem CID 145093037) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane.
| Compound Name | 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane |
|---|---|
| PubChem CID | 145093037 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 9-amino-4,5-dihydro-1,4-benzoxazepin-3-one;ethane |
| SMILES | CC.Nc1cccc2c1OCC(=O)NC2 |
| InChI | InChI=1S/C9H10N2O2.C2H6/c10-7-3-1-2-6-4-11-8(12)5-13-9(6)7;1-2/h1-3H,4-5,10H2,(H,11,12);1-2H3 |
| InChIKey | PMKUICWAAMEAEH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|