C8H10BrNO — CID 168986288
2,3-dihydro-1-benzofuran-7-amine;hydrobromide (PubChem CID 168986288) has the molecular formula C8H10BrNO and a molecular weight of 216.08 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-7-amine;hydrobromide.
| Compound Name | 2,3-dihydro-1-benzofuran-7-amine;hydrobromide |
|---|---|
| PubChem CID | 168986288 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-7-amine;hydrobromide |
| SMILES | Br.Nc1cccc2c1OCC2 |
| InChI | InChI=1S/C8H9NO.BrH/c9-7-3-1-2-6-4-5-10-8(6)7;/h1-3H,4-5,9H2;1H |
| InChIKey | TWXBEHAFMMZJAO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|