C11H16O — CID 91503061
ethane;7-methyl-2,3-dihydro-1-benzofuran (PubChem CID 91503061) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane;7-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | ethane;7-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 91503061 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | ethane;7-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CC.Cc1cccc2c1OCC2 |
| InChI | InChI=1S/C9H10O.C2H6/c1-7-3-2-4-8-5-6-10-9(7)8;1-2/h2-4H,5-6H2,1H3;1-2H3 |
| InChIKey | OCPBSICILJPQTH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |