C10H10O2 — CID 23513095
8-methyl-3,4-dihydrochromen-2-one (PubChem CID 23513095) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 8-methyl-3,4-dihydrochromen-2-one.
| Compound Name | 8-methyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 23513095 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 8-methyl-3,4-dihydrochromen-2-one |
| SMILES | Cc1cccc2c1OC(=O)CC2 |
| InChI | InChI=1S/C10H10O2/c1-7-3-2-4-8-5-6-9(11)12-10(7)8/h2-4H,5-6H2,1H3 |
| InChIKey | WQHAWQJLMGDBOS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|