C15H15ClO — CID 71399659
2-chloro-5,9a-dimethyl-1,9-dihydroxanthene (PubChem CID 71399659) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-chloro-5,9a-dimethyl-1,9-dihydroxanthene.
| Compound Name | 2-chloro-5,9a-dimethyl-1,9-dihydroxanthene |
|---|---|
| PubChem CID | 71399659 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-chloro-5,9a-dimethyl-1,9-dihydroxanthene |
| SMILES | Cc1cccc2c1OC1=CC=C(Cl)CC1(C)C2 |
| InChI | InChI=1S/C15H15ClO/c1-10-4-3-5-11-8-15(2)9-12(16)6-7-13(15)17-14(10)11/h3-7H,8-9H2,1-2H3 |
| InChIKey | CISQBECWHBGYCM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |