C8H9O2P — CID 143914921
8-methyl-4H-1,3,2-benzodioxaphosphinine (PubChem CID 143914921) has the molecular formula C8H9O2P and a molecular weight of 168.13 g/mol. Its IUPAC name is 8-methyl-4H-1,3,2-benzodioxaphosphinine.
| Compound Name | 8-methyl-4H-1,3,2-benzodioxaphosphinine |
|---|---|
| PubChem CID | 143914921 |
| Molecular Formula | C8H9O2P |
| Molecular Weight | 168.13 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 8-methyl-4H-1,3,2-benzodioxaphosphinine |
| SMILES | Cc1cccc2c1OPOC2 |
| InChI | InChI=1S/C8H9O2P/c1-6-3-2-4-7-5-9-11-10-8(6)7/h2-4,11H,5H2,1H3 |
| InChIKey | QSYOEWQBZZMASU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|