About 8-methyl-4H-1,3,2-benzodioxaphosphinine
8-methyl-4H-1,3,2-benzodioxaphosphinine (PubChem CID 143914921) has the molecular formula C8H9O2P
and a molecular weight of 168.13 g/mol. Its IUPAC name is 8-methyl-4H-1,3,2-benzodioxaphosphinine.
Molecular Properties
| Compound Name | 8-methyl-4H-1,3,2-benzodioxaphosphinine |
| PubChem CID | 143914921 |
| Molecular Formula | C8H9O2P |
| Molecular Weight | 168.13 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 8-methyl-4H-1,3,2-benzodioxaphosphinine |
| SMILES | Cc1cccc2c1OPOC2 |
| InChI | InChI=1S/C8H9O2P/c1-6-3-2-4-7-5-9-11-10-8(6)7/h2-4,11H,5H2,1H3 |
| InChIKey | QSYOEWQBZZMASU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-4H-1,3,2-benzodioxaphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4H-1,3,2-benzodioxaphosphinine?
The IUPAC name of 8-methyl-4H-1,3,2-benzodioxaphosphinine (CID 143914921) is 8-methyl-4H-1,3,2-benzodioxaphosphinine.
What is the SMILES notation for 8-methyl-4H-1,3,2-benzodioxaphosphinine?
The canonical SMILES for 8-methyl-4H-1,3,2-benzodioxaphosphinine is Cc1cccc2c1OPOC2.
What is the InChIKey of 8-methyl-4H-1,3,2-benzodioxaphosphinine?
The InChIKey is QSYOEWQBZZMASU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2P/c1-6-3-2-4-7-5-9-11-10-8(6)7/h2-4,11H,5H2,1H3.
What are the key properties of 8-methyl-4H-1,3,2-benzodioxaphosphinine?
8-methyl-4H-1,3,2-benzodioxaphosphinine has a molecular weight of 168.13 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4H-1,3,2-benzodioxaphosphinine is sourced from PubChem (CID 143914921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).