About N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine
N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine (PubChem CID 70260688) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine |
| PubChem CID | 70260688 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine |
| SMILES | CNCCC1Cc2cccc(C)c2O1 |
| InChI | InChI=1S/C12H17NO/c1-9-4-3-5-10-8-11(6-7-13-2)14-12(9)10/h3-5,11,13H,6-8H2,1-2H3 |
| InChIKey | NBNNGEIBCAKFBY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine?
The IUPAC name of N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine (CID 70260688) is N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine.
What is the SMILES notation for N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine?
The canonical SMILES for N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine is CNCCC1Cc2cccc(C)c2O1.
What is the InChIKey of N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine?
The InChIKey is NBNNGEIBCAKFBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9-4-3-5-10-8-11(6-7-13-2)14-12(9)10/h3-5,11,13H,6-8H2,1-2H3.
What are the key properties of N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine?
N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine has a molecular weight of 191.27 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(7-methyl-2,3-dihydro-1-benzofuran-2-yl)ethanamine is sourced from PubChem (CID 70260688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).