C17H17NO3 — CID 68963532
(7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methylcarbamic acid (PubChem CID 68963532) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methylcarbamic acid.
| Compound Name | (7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methylcarbamic acid |
|---|---|
| PubChem CID | 68963532 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methylcarbamic acid |
| SMILES | O=C(O)NCC1Cc2cccc(Cc3ccccc3)c2O1 |
| InChI | InChI=1S/C17H17NO3/c19-17(20)18-11-15-10-14-8-4-7-13(16(14)21-15)9-12-5-2-1-3-6-12/h1-8,15,18H,9-11H2,(H,19,20) |
| InChIKey | RFEXIULYJYNSGN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |