C23H22O4S — CID 86599065
(7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate (PubChem CID 86599065) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is (7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599065 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (7-benzyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3cccc(Cc4ccccc4)c3O2)cc1 |
| InChI | InChI=1S/C23H22O4S/c1-17-10-12-22(13-11-17)28(24,25)26-16-21-15-20-9-5-8-19(23(20)27-21)14-18-6-3-2-4-7-18/h2-13,21H,14-16H2,1H3 |
| InChIKey | FAAMIHUYFJYNGJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|