C24H24O6S — CID 86599152
[7-(2,5-dimethoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599152) has the molecular formula C24H24O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is [7-(2,5-dimethoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(2,5-dimethoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599152 |
| Molecular Formula | C24H24O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [7-(2,5-dimethoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc(OC)c(-c2cccc3c2OC(COS(=O)(=O)c2ccc(C)cc2)C3)c1 |
| InChI | InChI=1S/C24H24O6S/c1-16-7-10-20(11-8-16)31(25,26)29-15-19-13-17-5-4-6-21(24(17)30-19)22-14-18(27-2)9-12-23(22)28-3/h4-12,14,19H,13,15H2,1-3H3 |
| InChIKey | XDIYQTIXEKYCOW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|