C23H20Cl2O5S — CID 86599334
[7-(2,3-dichlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599334) has the molecular formula C23H20Cl2O5S and a molecular weight of 479.38 g/mol. Its IUPAC name is [7-(2,3-dichlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(2,3-dichlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599334 |
| Molecular Formula | C23H20Cl2O5S |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | [7-(2,3-dichlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1cc2c(c(-c3cccc(Cl)c3Cl)c1)OC(COS(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C23H20Cl2O5S/c1-14-6-8-18(9-7-14)31(26,27)29-13-17-11-15-10-16(28-2)12-20(23(15)30-17)19-4-3-5-21(24)22(19)25/h3-10,12,17H,11,13H2,1-2H3 |
| InChIKey | YJNJWLQEYXDIJV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|