C22H18Cl2O5S — CID 87756379
[(3R)-5-(2,6-dichlorophenyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87756379) has the molecular formula C22H18Cl2O5S and a molecular weight of 465.35 g/mol. Its IUPAC name is [(3R)-5-(2,6-dichlorophenyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R)-5-(2,6-dichlorophenyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87756379 |
| Molecular Formula | C22H18Cl2O5S |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | [(3R)-5-(2,6-dichlorophenyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2COc3cccc(-c4c(Cl)cccc4Cl)c3O2)cc1 |
| InChI | InChI=1S/C22H18Cl2O5S/c1-14-8-10-16(11-9-14)30(25,26)28-13-15-12-27-20-7-2-4-17(22(20)29-15)21-18(23)5-3-6-19(21)24/h2-11,15H,12-13H2,1H3/t15-/m1/s1 |
| InChIKey | OUPFKVVIZKMOHW-OAHLLOKOSA-N |
| XLogP | 5.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|