C19H21NO5S — CID 87781178
[6-amino-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87781178) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is [6-amino-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [6-amino-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87781178 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [6-amino-5-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C/C=C\c1c(N)ccc2c1OC(COS(=O)(=O)c1ccc(C)cc1)CO2 |
| InChI | InChI=1S/C19H21NO5S/c1-3-4-16-17(20)9-10-18-19(16)25-14(11-23-18)12-24-26(21,22)15-7-5-13(2)6-8-15/h3-10,14H,11-12,20H2,1-2H3/b4-3- |
| InChIKey | UUBXQMVVFPQXMN-ARJAWSKDSA-N |
| XLogP | 3.16 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|