C18H16O6S — CID 87955105
[(2S)-2,3-dihydrofuro[2,3-h][1,4]benzodioxin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87955105) has the molecular formula C18H16O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is [(2S)-2,3-dihydrofuro[2,3-h][1,4]benzodioxin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2,3-dihydrofuro[2,3-h][1,4]benzodioxin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87955105 |
| Molecular Formula | C18H16O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [(2S)-2,3-dihydrofuro[2,3-h][1,4]benzodioxin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2COc3ccc4occc4c3O2)cc1 |
| InChI | InChI=1S/C18H16O6S/c1-12-2-4-14(5-3-12)25(19,20)23-11-13-10-22-17-7-6-16-15(8-9-21-16)18(17)24-13/h2-9,13H,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | LNFZNYSDLZYRPE-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|