C19H17NO5S — CID 12042423
[(2R)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 12042423) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is [(2R)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12042423 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [(2R)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2COc3ccc4ncccc4c3O2)cc1 |
| InChI | InChI=1S/C19H17NO5S/c1-13-4-6-15(7-5-13)26(21,22)24-12-14-11-23-18-9-8-17-16(19(18)25-14)3-2-10-20-17/h2-10,14H,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | BYZDSXGYKFQCAJ-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|