C17H19NO6S — CID 86586357
[(2S)-7-amino-6-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86586357) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [(2S)-7-amino-6-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S)-7-amino-6-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86586357 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [(2S)-7-amino-6-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1cc2c(cc1N)O[C@H](COS(=O)(=O)c1ccc(C)cc1)CO2 |
| InChI | InChI=1S/C17H19NO6S/c1-11-3-5-13(6-4-11)25(19,20)23-10-12-9-22-16-8-15(21-2)14(18)7-17(16)24-12/h3-8,12H,9-10,18H2,1-2H3/t12-/m0/s1 |
| InChIKey | WHPNUJLSOTWGGP-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|