C16H14F2O5S — CID 143885464
(6,7-difluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 2-methylbenzenesulfonate (PubChem CID 143885464) has the molecular formula C16H14F2O5S and a molecular weight of 356.35 g/mol. Its IUPAC name is (6,7-difluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 2-methylbenzenesulfonate.
| Compound Name | (6,7-difluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 143885464 |
| Molecular Formula | C16H14F2O5S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (6,7-difluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)OCC1COc2cc(F)c(F)cc2O1 |
| InChI | InChI=1S/C16H14F2O5S/c1-10-4-2-3-5-16(10)24(19,20)22-9-11-8-21-14-6-12(17)13(18)7-15(14)23-11/h2-7,11H,8-9H2,1H3 |
| InChIKey | IIPOAYSCUGDXBW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|