C12H13FO6S — CID 164829829
[(2R)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-2-yl]methyl methanesulfonate (PubChem CID 164829829) has the molecular formula C12H13FO6S and a molecular weight of 304.30 g/mol. Its IUPAC name is [(2R)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-2-yl]methyl methanesulfonate.
| Compound Name | [(2R)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 164829829 |
| Molecular Formula | C12H13FO6S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | [(2R)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-2-yl]methyl methanesulfonate |
| SMILES | CC(=O)c1cc(F)cc2c1OC[C@H](COS(C)(=O)=O)O2 |
| InChI | InChI=1S/C12H13FO6S/c1-7(14)10-3-8(13)4-11-12(10)17-5-9(19-11)6-18-20(2,15)16/h3-4,9H,5-6H2,1-2H3/t9-/m1/s1 |
| InChIKey | WRTITNJVPYPDSJ-SECBINFHSA-N |
| XLogP | 1.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|