C10H9FN4O3 — CID 164829825
(2S)-2-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 164829825) has the molecular formula C10H9FN4O3 and a molecular weight of 252.21 g/mol. Its IUPAC name is (2S)-2-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | (2S)-2-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 164829825 |
| Molecular Formula | C10H9FN4O3 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (2S)-2-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | [N-]=[N+]=NC[C@H]1COc2c(cc(F)cc2C(N)=O)O1 |
| InChI | InChI=1S/C10H9FN4O3/c11-5-1-7(10(12)16)9-8(2-5)18-6(4-17-9)3-14-15-13/h1-2,6H,3-4H2,(H2,12,16)/t6-/m0/s1 |
| InChIKey | ZFTGPDFHJSAITB-LURJTMIESA-N |
| XLogP | 1.37 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|