C10H8N4O4 — CID 86587693
(8S)-8-(azidomethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-g][1,3]benzoxazol-2-one (PubChem CID 86587693) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is (8S)-8-(azidomethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-g][1,3]benzoxazol-2-one.
| Compound Name | (8S)-8-(azidomethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-g][1,3]benzoxazol-2-one |
|---|---|
| PubChem CID | 86587693 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (8S)-8-(azidomethyl)-7,8-dihydro-3H-[1,4]dioxino[2,3-g][1,3]benzoxazol-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1COc2ccc3[nH]c(=O)oc3c2O1 |
| InChI | InChI=1S/C10H8N4O4/c11-14-12-3-5-4-16-7-2-1-6-8(9(7)17-5)18-10(15)13-6/h1-2,5H,3-4H2,(H,13,15)/t5-/m0/s1 |
| InChIKey | NAOLIHPGLHRVGO-YFKPBYRVSA-N |
| XLogP | 1.57 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|