C12H10N4O2 — CID 23369847
2-(azidomethyl)-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one (PubChem CID 23369847) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-(azidomethyl)-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one.
| Compound Name | 2-(azidomethyl)-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one |
|---|---|
| PubChem CID | 23369847 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(azidomethyl)-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one |
| SMILES | [N-]=[N+]=NCC1Cc2ccc3[nH]c(=O)ccc3c2O1 |
| InChI | InChI=1S/C12H10N4O2/c13-16-14-6-8-5-7-1-3-10-9(12(7)18-8)2-4-11(17)15-10/h1-4,8H,5-6H2,(H,15,17) |
| InChIKey | CZLVBZFSLCXSAC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|