C9H10BN3O3 — CID 86236191
[2-(azidomethyl)-2,3-dihydro-1-benzofuran-7-yl]boronic acid (PubChem CID 86236191) has the molecular formula C9H10BN3O3 and a molecular weight of 219.01 g/mol. Its IUPAC name is [2-(azidomethyl)-2,3-dihydro-1-benzofuran-7-yl]boronic acid.
| Compound Name | [2-(azidomethyl)-2,3-dihydro-1-benzofuran-7-yl]boronic acid |
|---|---|
| PubChem CID | 86236191 |
| Molecular Formula | C9H10BN3O3 |
| Molecular Weight | 219.01 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | [2-(azidomethyl)-2,3-dihydro-1-benzofuran-7-yl]boronic acid |
| SMILES | [N-]=[N+]=NCC1Cc2cccc(B(O)O)c2O1 |
| InChI | InChI=1S/C9H10BN3O3/c11-13-12-5-7-4-6-2-1-3-8(10(14)15)9(6)16-7/h1-3,7,14-15H,4-5H2 |
| InChIKey | PZQQEYRDNOIDEB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.01 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|