C13H15N3O — CID 90748480
2-(azidomethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran (PubChem CID 90748480) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(azidomethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran.
| Compound Name | 2-(azidomethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran |
|---|---|
| PubChem CID | 90748480 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(azidomethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran |
| SMILES | [N-]=[N+]=NCC1Cc2cc3c(cc2O1)CCCC3 |
| InChI | InChI=1S/C13H15N3O/c14-16-15-8-12-6-11-5-9-3-1-2-4-10(9)7-13(11)17-12/h5,7,12H,1-4,6,8H2 |
| InChIKey | SENOJWUYOGZUSB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|