C10H8N4O — CID 94046378
(2S)-2-(azidomethyl)-2,3-dihydro-1-benzofuran-5-carbonitrile (PubChem CID 94046378) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is (2S)-2-(azidomethyl)-2,3-dihydro-1-benzofuran-5-carbonitrile.
| Compound Name | (2S)-2-(azidomethyl)-2,3-dihydro-1-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 94046378 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (2S)-2-(azidomethyl)-2,3-dihydro-1-benzofuran-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C[C@@H](CN=[N+]=[N-])O2 |
| InChI | InChI=1S/C10H8N4O/c11-5-7-1-2-10-8(3-7)4-9(15-10)6-13-14-12/h1-3,9H,4,6H2/t9-/m0/s1 |
| InChIKey | ZLXOSESSTLKMFL-VIFPVBQESA-N |
| XLogP | 2.17 |
| TPSA | 81.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|