C16H13NO — CID 500476
3-phenyl-3,4-dihydro-2H-chromene-6-carbonitrile (PubChem CID 500476) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-phenyl-3,4-dihydro-2H-chromene-6-carbonitrile.
| Compound Name | 3-phenyl-3,4-dihydro-2H-chromene-6-carbonitrile |
|---|---|
| PubChem CID | 500476 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-phenyl-3,4-dihydro-2H-chromene-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CC(c1ccccc1)CO2 |
| InChI | InChI=1S/C16H13NO/c17-10-12-6-7-16-14(8-12)9-15(11-18-16)13-4-2-1-3-5-13/h1-8,15H,9,11H2 |
| InChIKey | ASPSPMUTJMKLJC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |