C10H9NO — CID 102491716
3-methyl-2,3-dihydro-1-benzofuran-6-carbonitrile (PubChem CID 102491716) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-methyl-2,3-dihydro-1-benzofuran-6-carbonitrile.
| Compound Name | 3-methyl-2,3-dihydro-1-benzofuran-6-carbonitrile |
|---|---|
| PubChem CID | 102491716 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 3-methyl-2,3-dihydro-1-benzofuran-6-carbonitrile |
| SMILES | CC1COc2cc(C#N)ccc21 |
| InChI | InChI=1S/C10H9NO/c1-7-6-12-10-4-8(5-11)2-3-9(7)10/h2-4,7H,6H2,1H3 |
| InChIKey | NCZPFTIJRDWIKR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |