C13H14BrNO — CID 18986522
5-(2-bromoethyl)-2,3,4,5-tetrahydro-1-benzoxepine-8-carbonitrile (PubChem CID 18986522) has the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. Its IUPAC name is 5-(2-bromoethyl)-2,3,4,5-tetrahydro-1-benzoxepine-8-carbonitrile.
| Compound Name | 5-(2-bromoethyl)-2,3,4,5-tetrahydro-1-benzoxepine-8-carbonitrile |
|---|---|
| PubChem CID | 18986522 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 5-(2-bromoethyl)-2,3,4,5-tetrahydro-1-benzoxepine-8-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)OCCCC2CCBr |
| InChI | InChI=1S/C13H14BrNO/c14-6-5-11-2-1-7-16-13-8-10(9-15)3-4-12(11)13/h3-4,8,11H,1-2,5-7H2 |
| InChIKey | RRYIHAZZUCBABJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|