C17H16N2O2 — CID 104768058
3-amino-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)benzonitrile (PubChem CID 104768058) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-amino-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)benzonitrile.
| Compound Name | 3-amino-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 104768058 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-amino-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCC2CCOc3ccccc32)c(N)c1 |
| InChI | InChI=1S/C17H16N2O2/c18-10-12-5-6-17(15(19)9-12)21-11-13-7-8-20-16-4-2-1-3-14(13)16/h1-6,9,13H,7-8,11,19H2 |
| InChIKey | YPVHQWRRDBYBQB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|