C16H15IO2 — CID 113451150
4-[(2-iodophenoxy)methyl]-3,4-dihydro-2H-chromene (PubChem CID 113451150) has the molecular formula C16H15IO2 and a molecular weight of 366.20 g/mol. Its IUPAC name is 4-[(2-iodophenoxy)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[(2-iodophenoxy)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 113451150 |
| Molecular Formula | C16H15IO2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 4-[(2-iodophenoxy)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Ic1ccccc1OCC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H15IO2/c17-14-6-2-4-8-16(14)19-11-12-9-10-18-15-7-3-1-5-13(12)15/h1-8,12H,9-11H2 |
| InChIKey | PSYKCWYVFCUGIN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|