C16H15FO2 — CID 104771987
4-[(4-fluorophenoxy)methyl]-3,4-dihydro-2H-chromene (PubChem CID 104771987) has the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 4-[(4-fluorophenoxy)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[(4-fluorophenoxy)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 104771987 |
| Molecular Formula | C16H15FO2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-[(4-fluorophenoxy)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Fc1ccc(OCC2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15FO2/c17-13-5-7-14(8-6-13)19-11-12-9-10-18-16-4-2-1-3-15(12)16/h1-8,12H,9-11H2 |
| InChIKey | OHZYYWHZTKFNRS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |