C16H17NO3 — CID 104768743
[5-(3,4-dihydro-2H-chromen-4-ylmethoxy)-2-pyridinyl]methanol (PubChem CID 104768743) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is [5-(3,4-dihydro-2H-chromen-4-ylmethoxy)-2-pyridinyl]methanol.
| Compound Name | [5-(3,4-dihydro-2H-chromen-4-ylmethoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 104768743 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [5-(3,4-dihydro-2H-chromen-4-ylmethoxy)-2-pyridinyl]methanol |
| SMILES | OCc1ccc(OCC2CCOc3ccccc32)cn1 |
| InChI | InChI=1S/C16H17NO3/c18-10-13-5-6-14(9-17-13)20-11-12-7-8-19-16-4-2-1-3-15(12)16/h1-6,9,12,18H,7-8,10-11H2 |
| InChIKey | JWIBRLUSEFQDIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |