C17H17BrO3 — CID 104768732
[3-bromo-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)phenyl]methanol (PubChem CID 104768732) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is [3-bromo-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)phenyl]methanol.
| Compound Name | [3-bromo-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 104768732 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [3-bromo-4-(3,4-dihydro-2H-chromen-4-ylmethoxy)phenyl]methanol |
| SMILES | OCc1ccc(OCC2CCOc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C17H17BrO3/c18-15-9-12(10-19)5-6-17(15)21-11-13-7-8-20-16-4-2-1-3-14(13)16/h1-6,9,13,19H,7-8,10-11H2 |
| InChIKey | GIGGXLAEXRZIBO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |