C17H17BrO2 — CID 104768526
4-[(2-bromo-4-methylphenoxy)methyl]-3,4-dihydro-2H-chromene (PubChem CID 104768526) has the molecular formula C17H17BrO2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 4-[(2-bromo-4-methylphenoxy)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[(2-bromo-4-methylphenoxy)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 104768526 |
| Molecular Formula | C17H17BrO2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-[(2-bromo-4-methylphenoxy)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Cc1ccc(OCC2CCOc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C17H17BrO2/c1-12-6-7-17(15(18)10-12)20-11-13-8-9-19-16-5-3-2-4-14(13)16/h2-7,10,13H,8-9,11H2,1H3 |
| InChIKey | ZTDORZDIDJGEHF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |