C10H11IO — CID 92908096
(4R)-4-(iodomethyl)-3,4-dihydro-2H-chromene (PubChem CID 92908096) has the molecular formula C10H11IO and a molecular weight of 274.10 g/mol. Its IUPAC name is (4R)-4-(iodomethyl)-3,4-dihydro-2H-chromene.
| Compound Name | (4R)-4-(iodomethyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 92908096 |
| Molecular Formula | C10H11IO |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (4R)-4-(iodomethyl)-3,4-dihydro-2H-chromene |
| SMILES | IC[C@@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C10H11IO/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-4,8H,5-7H2/t8-/m0/s1 |
| InChIKey | WUBBCYRDJZNINH-QMMMGPOBSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|